C13H23IN2 — CID 11045888
N,5,5-trimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide (PubChem CID 11045888) has the molecular formula C13H23IN2 and a molecular weight of 334.25 g/mol. Its IUPAC name is N,5,5-trimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide.
| Compound Name | N,5,5-trimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide |
|---|---|
| PubChem CID | 11045888 |
| Molecular Formula | C13H23IN2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N,5,5-trimethyl-3-pyrrolidin-1-ium-1-ylidenecyclohexen-1-amine iodide |
| SMILES | CNC1=CC(=[N+]2CCCC2)CC(C)(C)C1.[I-] |
| InChI | InChI=1S/C13H22N2.HI/c1-13(2)9-11(14-3)8-12(10-13)15-6-4-5-7-15;/h8H,4-7,9-10H2,1-3H3;1H |
| InChIKey | DMFADOUGLYABOF-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|