C14H14ClN5O3 — CID 110459173
2-[3-(2-chloro-5-nitrophenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-yl]acetamide (PubChem CID 110459173) has the molecular formula C14H14ClN5O3 and a molecular weight of 335.75 g/mol. Its IUPAC name is 2-[3-(2-chloro-5-nitrophenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-yl]acetamide.
| Compound Name | 2-[3-(2-chloro-5-nitrophenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-yl]acetamide |
|---|---|
| PubChem CID | 110459173 |
| Molecular Formula | C14H14ClN5O3 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-[3-(2-chloro-5-nitrophenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-yl]acetamide |
| SMILES | NC(=O)Cn1nc(-c2cc([N+](=O)[O-])ccc2Cl)c2c1CCNC2 |
| InChI | InChI=1S/C14H14ClN5O3/c15-11-2-1-8(20(22)23)5-9(11)14-10-6-17-4-3-12(10)19(18-14)7-13(16)21/h1-2,5,17H,3-4,6-7H2,(H2,16,21) |
| InChIKey | XPOLDZKQJKNXHV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|