C14H18N2O — CID 110461207
(2E,4E)-N-methyl-N-(2-pyridin-4-ylethyl)hexa-2,4-dienamide (PubChem CID 110461207) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (2E,4E)-N-methyl-N-(2-pyridin-4-ylethyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-methyl-N-(2-pyridin-4-ylethyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 110461207 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (2E,4E)-N-methyl-N-(2-pyridin-4-ylethyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C14H18N2O/c1-3-4-5-6-14(17)16(2)12-9-13-7-10-15-11-8-13/h3-8,10-11H,9,12H2,1-2H3/b4-3+,6-5+ |
| InChIKey | GLLKKJPWKJJUIP-VNKDHWASSA-N |
| XLogP | 2.21 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|