C21H25NO4 — CID 11046471
N-(2,4-dimethoxy-3-methyl-5-phenylmethoxy-6-prop-2-enylphenyl)acetamide (PubChem CID 11046471) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is N-(2,4-dimethoxy-3-methyl-5-phenylmethoxy-6-prop-2-enylphenyl)acetamide.
| Compound Name | N-(2,4-dimethoxy-3-methyl-5-phenylmethoxy-6-prop-2-enylphenyl)acetamide |
|---|---|
| PubChem CID | 11046471 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-(2,4-dimethoxy-3-methyl-5-phenylmethoxy-6-prop-2-enylphenyl)acetamide |
| SMILES | C=CCc1c(NC(C)=O)c(OC)c(C)c(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H25NO4/c1-6-10-17-18(22-15(3)23)19(24-4)14(2)20(25-5)21(17)26-13-16-11-8-7-9-12-16/h6-9,11-12H,1,10,13H2,2-5H3,(H,22,23) |
| InChIKey | IASBRBDMBXZMRK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|