C20H21NO6 — CID 11046907
benzyl (2S)-5-oxo-2-[(5-oxo-2-prop-2-ynyloxolane-2-carbonyl)amino]pentanoate (PubChem CID 11046907) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is benzyl (2S)-5-oxo-2-[(5-oxo-2-prop-2-ynyloxolane-2-carbonyl)amino]pentanoate.
| Compound Name | benzyl (2S)-5-oxo-2-[(5-oxo-2-prop-2-ynyloxolane-2-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 11046907 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | benzyl (2S)-5-oxo-2-[(5-oxo-2-prop-2-ynyloxolane-2-carbonyl)amino]pentanoate |
| SMILES | C#CCC1(C(=O)N[C@@H](CCC=O)C(=O)OCc2ccccc2)CCC(=O)O1 |
| InChI | InChI=1S/C20H21NO6/c1-2-11-20(12-10-17(23)27-20)19(25)21-16(9-6-13-22)18(24)26-14-15-7-4-3-5-8-15/h1,3-5,7-8,13,16H,6,9-12,14H2,(H,21,25)/t16-,20?/m0/s1 |
| InChIKey | KHEDLXNNFSSLBM-DJZRFWRSSA-N |
| XLogP | 1.29 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|