C14H15FN2OS — CID 110472495
3-fluoro-N-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]benzamide (PubChem CID 110472495) has the molecular formula C14H15FN2OS and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-fluoro-N-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]benzamide.
| Compound Name | 3-fluoro-N-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 110472495 |
| Molecular Formula | C14H15FN2OS |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-fluoro-N-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]benzamide |
| SMILES | Cc1csc(C(C)(C)NC(=O)c2cccc(F)c2)n1 |
| InChI | InChI=1S/C14H15FN2OS/c1-9-8-19-13(16-9)14(2,3)17-12(18)10-5-4-6-11(15)7-10/h4-8H,1-3H3,(H,17,18) |
| InChIKey | XRUPLBJVMPUCRI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |