C15H21Cl2N3OS — CID 120644605
5-amino-2-methyl-N-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]benzamide;dihydrochloride (PubChem CID 120644605) has the molecular formula C15H21Cl2N3OS and a molecular weight of 362.33 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]benzamide;dihydrochloride.
| Compound Name | 5-amino-2-methyl-N-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 120644605 |
| Molecular Formula | C15H21Cl2N3OS |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 5-amino-2-methyl-N-[2-(4-methyl-1,3-thiazol-2-yl)propan-2-yl]benzamide;dihydrochloride |
| SMILES | Cc1csc(C(C)(C)NC(=O)c2cc(N)ccc2C)n1.Cl.Cl |
| InChI | InChI=1S/C15H19N3OS.2ClH/c1-9-5-6-11(16)7-12(9)13(19)18-15(3,4)14-17-10(2)8-20-14;;/h5-8H,16H2,1-4H3,(H,18,19);2*1H |
| InChIKey | QOEZKDYHHYICMC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|