C11H13N5O — CID 110472728
2-(4-aminophenyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide (PubChem CID 110472728) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide.
| Compound Name | 2-(4-aminophenyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 110472728 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-(4-aminophenyl)-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide |
| SMILES | Cc1nc(NC(=O)Cc2ccc(N)cc2)n[nH]1 |
| InChI | InChI=1S/C11H13N5O/c1-7-13-11(16-15-7)14-10(17)6-8-2-4-9(12)5-3-8/h2-5H,6,12H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | JFWHVFHMXQKOFR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|