C7H12N4O2 — CID 78927633
2-ethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide (PubChem CID 78927633) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-ethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide.
| Compound Name | 2-ethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 78927633 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-ethoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide |
| SMILES | CCOCC(=O)Nc1n[nH]c(C)n1 |
| InChI | InChI=1S/C7H12N4O2/c1-3-13-4-6(12)9-7-8-5(2)10-11-7/h3-4H2,1-2H3,(H2,8,9,10,11,12) |
| InChIKey | ISDGVDJTJSYVAF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |