C6H10N4O2 — CID 78927542
2-methoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide (PubChem CID 78927542) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-methoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide.
| Compound Name | 2-methoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 78927542 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-methoxy-N-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide |
| SMILES | COCC(=O)Nc1n[nH]c(C)n1 |
| InChI | InChI=1S/C6H10N4O2/c1-4-7-6(10-9-4)8-5(11)3-12-2/h3H2,1-2H3,(H2,7,8,9,10,11) |
| InChIKey | WEOGOEWDIQCPCR-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |