C14H17N3O — CID 110474610
N-(2,3-dimethylphenyl)-2-(1-methylimidazol-2-yl)acetamide (PubChem CID 110474610) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(1-methylimidazol-2-yl)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(1-methylimidazol-2-yl)acetamide |
|---|---|
| PubChem CID | 110474610 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(1-methylimidazol-2-yl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cc2nccn2C)c1C |
| InChI | InChI=1S/C14H17N3O/c1-10-5-4-6-12(11(10)2)16-14(18)9-13-15-7-8-17(13)3/h4-8H,9H2,1-3H3,(H,16,18) |
| InChIKey | IQSAQHZHVZUANF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |