C15H21N5O — CID 63015483
N-(3-amino-2-methylphenyl)-2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]acetamide (PubChem CID 63015483) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is N-(3-amino-2-methylphenyl)-2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]acetamide.
| Compound Name | N-(3-amino-2-methylphenyl)-2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 63015483 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-(3-amino-2-methylphenyl)-2-[methyl-[(1-methylimidazol-2-yl)methyl]amino]acetamide |
| SMILES | Cc1c(N)cccc1NC(=O)CN(C)Cc1nccn1C |
| InChI | InChI=1S/C15H21N5O/c1-11-12(16)5-4-6-13(11)18-15(21)10-19(2)9-14-17-7-8-20(14)3/h4-8H,9-10,16H2,1-3H3,(H,18,21) |
| InChIKey | GAAVIECSBZTCMR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|