C13H16N4O — CID 110474945
1,4-diazepan-1-yl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 110474945) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 1,4-diazepan-1-yl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | 1,4-diazepan-1-yl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 110474945 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1,4-diazepan-1-yl(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | O=C(c1c[nH]c2ncccc12)N1CCCNCC1 |
| InChI | InChI=1S/C13H16N4O/c18-13(17-7-2-4-14-6-8-17)11-9-16-12-10(11)3-1-5-15-12/h1,3,5,9,14H,2,4,6-8H2,(H,15,16) |
| InChIKey | VDFLXKKIJRPAPL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |