C15H28N4O2 — CID 110476311
N-[3-(diethylamino)propyl]-3-(4,5-dimethyl-2-oxo-1H-imidazol-3-yl)propanamide (PubChem CID 110476311) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-3-(4,5-dimethyl-2-oxo-1H-imidazol-3-yl)propanamide.
| Compound Name | N-[3-(diethylamino)propyl]-3-(4,5-dimethyl-2-oxo-1H-imidazol-3-yl)propanamide |
|---|---|
| PubChem CID | 110476311 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | N-[3-(diethylamino)propyl]-3-(4,5-dimethyl-2-oxo-1H-imidazol-3-yl)propanamide |
| SMILES | CCN(CC)CCCNC(=O)CCn1c(C)c(C)[nH]c1=O |
| InChI | InChI=1S/C15H28N4O2/c1-5-18(6-2)10-7-9-16-14(20)8-11-19-13(4)12(3)17-15(19)21/h5-11H2,1-4H3,(H,16,20)(H,17,21) |
| InChIKey | QPCDIHVSLLJVDJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|