C19H19BrClNO — CID 110476879
N-[1-[1-(4-bromophenyl)cyclopropyl]ethyl]-2-(4-chlorophenyl)acetamide (PubChem CID 110476879) has the molecular formula C19H19BrClNO and a molecular weight of 392.72 g/mol. Its IUPAC name is N-[1-[1-(4-bromophenyl)cyclopropyl]ethyl]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[1-[1-(4-bromophenyl)cyclopropyl]ethyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 110476879 |
| Molecular Formula | C19H19BrClNO |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | N-[1-[1-(4-bromophenyl)cyclopropyl]ethyl]-2-(4-chlorophenyl)acetamide |
| SMILES | CC(NC(=O)Cc1ccc(Cl)cc1)C1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H19BrClNO/c1-13(19(10-11-19)15-4-6-16(20)7-5-15)22-18(23)12-14-2-8-17(21)9-3-14/h2-9,13H,10-12H2,1H3,(H,22,23) |
| InChIKey | GTXOTFBPSUNOOA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |