C16H23NO3 — CID 110479476
N-[1-(3,4-dimethoxyphenyl)cyclopropyl]pentanamide (PubChem CID 110479476) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)cyclopropyl]pentanamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)cyclopropyl]pentanamide |
|---|---|
| PubChem CID | 110479476 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)cyclopropyl]pentanamide |
| SMILES | CCCCC(=O)NC1(c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C16H23NO3/c1-4-5-6-15(18)17-16(9-10-16)12-7-8-13(19-2)14(11-12)20-3/h7-8,11H,4-6,9-10H2,1-3H3,(H,17,18) |
| InChIKey | XGQITXPLRODXSG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |