C11H15N3O4 — CID 110480708
methyl 3-amino-4-[(2-amino-3-hydroxypropanoyl)amino]benzoate (PubChem CID 110480708) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is methyl 3-amino-4-[(2-amino-3-hydroxypropanoyl)amino]benzoate.
| Compound Name | methyl 3-amino-4-[(2-amino-3-hydroxypropanoyl)amino]benzoate |
|---|---|
| PubChem CID | 110480708 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | methyl 3-amino-4-[(2-amino-3-hydroxypropanoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(N)CO)c(N)c1 |
| InChI | InChI=1S/C11H15N3O4/c1-18-11(17)6-2-3-9(7(12)4-6)14-10(16)8(13)5-15/h2-4,8,15H,5,12-13H2,1H3,(H,14,16) |
| InChIKey | XFVUMBFFTLKCGY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|