C10H14N6O2 — CID 110482110
N-[2-(2-hydroxyethyl)-5-methylpyrazol-3-yl]-1-methyltriazole-4-carboxamide (PubChem CID 110482110) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is N-[2-(2-hydroxyethyl)-5-methylpyrazol-3-yl]-1-methyltriazole-4-carboxamide.
| Compound Name | N-[2-(2-hydroxyethyl)-5-methylpyrazol-3-yl]-1-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 110482110 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | N-[2-(2-hydroxyethyl)-5-methylpyrazol-3-yl]-1-methyltriazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cn(C)nn2)n(CCO)n1 |
| InChI | InChI=1S/C10H14N6O2/c1-7-5-9(16(13-7)3-4-17)11-10(18)8-6-15(2)14-12-8/h5-6,17H,3-4H2,1-2H3,(H,11,18) |
| InChIKey | UUIVSXASPCRGFO-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |