C25H29O2+ — CID 11048599
[(2E,4E,6E)-7-ethoxy-1,7-bis(4-methylphenyl)hepta-2,4,6-trienylidene]-ethyloxidanium (PubChem CID 11048599) has the molecular formula C25H29O2+ and a molecular weight of 361.51 g/mol. Its IUPAC name is [(2E,4E,6E)-7-ethoxy-1,7-bis(4-methylphenyl)hepta-2,4,6-trienylidene]-ethyloxidanium.
| Compound Name | [(2E,4E,6E)-7-ethoxy-1,7-bis(4-methylphenyl)hepta-2,4,6-trienylidene]-ethyloxidanium |
|---|---|
| PubChem CID | 11048599 |
| Molecular Formula | C25H29O2+ |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | [(2E,4E,6E)-7-ethoxy-1,7-bis(4-methylphenyl)hepta-2,4,6-trienylidene]-ethyloxidanium |
| SMILES | CCO/C(=C/C=C/C=C/C(=[O+]\CC)c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H29O2/c1-5-26-24(22-16-12-20(3)13-17-22)10-8-7-9-11-25(27-6-2)23-18-14-21(4)15-19-23/h7-19H,5-6H2,1-4H3/q+1/b8-7+,11-9+,24-10+ |
| InChIKey | FXGSXEPKUWHDRS-MGSWBBQZSA-N |
| XLogP | 6.23 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|