C18H22N2O2Se2 — CID 11048737
3,7-bis(4-methoxyphenyl)-1,5,3,7-diselenadiazocane (PubChem CID 11048737) has the molecular formula C18H22N2O2Se2 and a molecular weight of 456.31 g/mol. Its IUPAC name is 3,7-bis(4-methoxyphenyl)-1,5,3,7-diselenadiazocane.
| Compound Name | 3,7-bis(4-methoxyphenyl)-1,5,3,7-diselenadiazocane |
|---|---|
| PubChem CID | 11048737 |
| Molecular Formula | C18H22N2O2Se2 |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 3,7-bis(4-methoxyphenyl)-1,5,3,7-diselenadiazocane |
| SMILES | COc1ccc(N2C[Se]CN(c3ccc(OC)cc3)C[Se]C2)cc1 |
| InChI | InChI=1S/C18H22N2O2Se2/c1-21-17-7-3-15(4-8-17)19-11-23-13-20(14-24-12-19)16-5-9-18(22-2)10-6-16/h3-10H,11-14H2,1-2H3 |
| InChIKey | ZIFVHODLYKFCHB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|