C13H12N6O3 — CID 110491925
1,3-dimethyl-2,6-dioxo-N-pyridin-2-ylpurine-9-carboxamide (PubChem CID 110491925) has the molecular formula C13H12N6O3 and a molecular weight of 300.28 g/mol. Its IUPAC name is 1,3-dimethyl-2,6-dioxo-N-pyridin-2-ylpurine-9-carboxamide.
| Compound Name | 1,3-dimethyl-2,6-dioxo-N-pyridin-2-ylpurine-9-carboxamide |
|---|---|
| PubChem CID | 110491925 |
| Molecular Formula | C13H12N6O3 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1,3-dimethyl-2,6-dioxo-N-pyridin-2-ylpurine-9-carboxamide |
| SMILES | Cn1c(=O)c2ncn(C(=O)Nc3ccccn3)c2n(C)c1=O |
| InChI | InChI=1S/C13H12N6O3/c1-17-10-9(11(20)18(2)13(17)22)15-7-19(10)12(21)16-8-5-3-4-6-14-8/h3-7H,1-2H3,(H,14,16,21) |
| InChIKey | JCVAAYFFGKSSHI-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |