C19H21N5O3 — CID 110493323
(E)-3-(2,5-dimethoxyphenyl)-N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]prop-2-enamide (PubChem CID 110493323) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 110493323 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)NCc2nnc3nc(C)cc(C)n23)c1 |
| InChI | InChI=1S/C19H21N5O3/c1-12-9-13(2)24-17(22-23-19(24)21-12)11-20-18(25)8-5-14-10-15(26-3)6-7-16(14)27-4/h5-10H,11H2,1-4H3,(H,20,25)/b8-5+ |
| InChIKey | NDSBUAFZKYHKBI-VMPITWQZSA-N |
| XLogP | 2.09 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|