C24H23N5O2 — CID 110493317
(E)-N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-3-(3-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 110493317) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is (E)-N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-3-(3-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-3-(3-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 110493317 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (E)-N-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]-3-(3-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)n2c(CNC(=O)/C=C/c3cccc(OCc4ccccc4)c3)nnc2n1 |
| InChI | InChI=1S/C24H23N5O2/c1-17-13-18(2)29-22(27-28-24(29)26-17)15-25-23(30)12-11-19-9-6-10-21(14-19)31-16-20-7-4-3-5-8-20/h3-14H,15-16H2,1-2H3,(H,25,30)/b12-11+ |
| InChIKey | ZCJWXKJHSQERFF-VAWYXSNFSA-N |
| XLogP | 3.65 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|