C22H24O2 — CID 110493699
5,6,7,8-tetrahydronaphthalen-2-yl (E)-3-(4-propan-2-ylphenyl)prop-2-enoate (PubChem CID 110493699) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalen-2-yl (E)-3-(4-propan-2-ylphenyl)prop-2-enoate.
| Compound Name | 5,6,7,8-tetrahydronaphthalen-2-yl (E)-3-(4-propan-2-ylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 110493699 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalen-2-yl (E)-3-(4-propan-2-ylphenyl)prop-2-enoate |
| SMILES | CC(C)c1ccc(/C=C/C(=O)Oc2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C22H24O2/c1-16(2)18-10-7-17(8-11-18)9-14-22(23)24-21-13-12-19-5-3-4-6-20(19)15-21/h7-16H,3-6H2,1-2H3/b14-9+ |
| InChIKey | HWDBXGBHDJLXTL-NTEUORMPSA-N |
| XLogP | 5.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|