C18H14N4O3 — CID 110493819
2-(1,3-dioxoisoindol-2-yl)-N-(5-methylimidazo[1,2-a]pyridin-6-yl)acetamide (PubChem CID 110493819) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(5-methylimidazo[1,2-a]pyridin-6-yl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(5-methylimidazo[1,2-a]pyridin-6-yl)acetamide |
|---|---|
| PubChem CID | 110493819 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(5-methylimidazo[1,2-a]pyridin-6-yl)acetamide |
| SMILES | Cc1c(NC(=O)CN2C(=O)c3ccccc3C2=O)ccc2nccn12 |
| InChI | InChI=1S/C18H14N4O3/c1-11-14(6-7-15-19-8-9-21(11)15)20-16(23)10-22-17(24)12-4-2-3-5-13(12)18(22)25/h2-9H,10H2,1H3,(H,20,23) |
| InChIKey | VCTFPAAUTGBWIO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|