C15H12N4O4 — CID 122301544
2-(1,3-dioxoisoindol-2-yl)-N-(2-methoxypyrimidin-5-yl)acetamide (PubChem CID 122301544) has the molecular formula C15H12N4O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(2-methoxypyrimidin-5-yl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-methoxypyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 122301544 |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-methoxypyrimidin-5-yl)acetamide |
| SMILES | COc1ncc(NC(=O)CN2C(=O)c3ccccc3C2=O)cn1 |
| InChI | InChI=1S/C15H12N4O4/c1-23-15-16-6-9(7-17-15)18-12(20)8-19-13(21)10-4-2-3-5-11(10)14(19)22/h2-7H,8H2,1H3,(H,18,20) |
| InChIKey | ZAOBMVYAIVWPEX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|