C22H34N2OSi — CID 11049497
1-[3-[(dimethylamino)methyl]-5-[(3-trimethylsilylphenyl)methoxy]phenyl]-N,N-dimethylmethanamine (PubChem CID 11049497) has the molecular formula C22H34N2OSi and a molecular weight of 370.61 g/mol. Its IUPAC name is 1-[3-[(dimethylamino)methyl]-5-[(3-trimethylsilylphenyl)methoxy]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[3-[(dimethylamino)methyl]-5-[(3-trimethylsilylphenyl)methoxy]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 11049497 |
| Molecular Formula | C22H34N2OSi |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-[3-[(dimethylamino)methyl]-5-[(3-trimethylsilylphenyl)methoxy]phenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cc(CN(C)C)cc(OCc2cccc([Si](C)(C)C)c2)c1 |
| InChI | InChI=1S/C22H34N2OSi/c1-23(2)15-19-11-20(16-24(3)4)13-21(12-19)25-17-18-9-8-10-22(14-18)26(5,6)7/h8-14H,15-17H2,1-7H3 |
| InChIKey | RQVFXFDGJBTTGI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|