C18H25NO3 — CID 110497204
(E)-3-[4-(methoxymethoxy)phenyl]-N-(2-methylcyclohexyl)prop-2-enamide (PubChem CID 110497204) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (E)-3-[4-(methoxymethoxy)phenyl]-N-(2-methylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(methoxymethoxy)phenyl]-N-(2-methylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 110497204 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (E)-3-[4-(methoxymethoxy)phenyl]-N-(2-methylcyclohexyl)prop-2-enamide |
| SMILES | COCOc1ccc(/C=C/C(=O)NC2CCCCC2C)cc1 |
| InChI | InChI=1S/C18H25NO3/c1-14-5-3-4-6-17(14)19-18(20)12-9-15-7-10-16(11-8-15)22-13-21-2/h7-12,14,17H,3-6,13H2,1-2H3,(H,19,20)/b12-9+ |
| InChIKey | ZWEUAACBSZMMSO-FMIVXFBMSA-N |
| XLogP | 3.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|