C16H21NO4 — CID 110497183
(E)-3-[4-(methoxymethoxy)phenyl]-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 110497183) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (E)-3-[4-(methoxymethoxy)phenyl]-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(methoxymethoxy)phenyl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 110497183 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (E)-3-[4-(methoxymethoxy)phenyl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | COCOc1ccc(/C=C/C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C16H21NO4/c1-19-12-21-14-7-4-13(5-8-14)6-9-16(18)17-11-15-3-2-10-20-15/h4-9,15H,2-3,10-12H2,1H3,(H,17,18)/b9-6+ |
| InChIKey | LYDJQNYLNOMDJI-RMKNXTFCSA-N |
| XLogP | 1.98 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|