C16H16AsN3O5 — CID 110500265
[4-[[2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxyacetyl]amino]phenyl]arsonic acid (PubChem CID 110500265) has the molecular formula C16H16AsN3O5 and a molecular weight of 405.24 g/mol. Its IUPAC name is [4-[[2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxyacetyl]amino]phenyl]arsonic acid.
| Compound Name | [4-[[2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxyacetyl]amino]phenyl]arsonic acid |
|---|---|
| PubChem CID | 110500265 |
| Molecular Formula | C16H16AsN3O5 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | [4-[[2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxyacetyl]amino]phenyl]arsonic acid |
| SMILES | Cc1cn2cccc(OCC(=O)Nc3ccc([As](=O)(O)O)cc3)c2n1 |
| InChI | InChI=1S/C16H16AsN3O5/c1-11-9-20-8-2-3-14(16(20)18-11)25-10-15(21)19-13-6-4-12(5-7-13)17(22,23)24/h2-9H,10H2,1H3,(H,19,21)(H2,22,23,24) |
| InChIKey | VOJZMLZZOIJXDU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|