C22H26N4O2 — CID 110500276
2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxy-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide (PubChem CID 110500276) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxy-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxy-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 110500276 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxy-N-[4-(4-methylpiperidin-1-yl)phenyl]acetamide |
| SMILES | Cc1cn2cccc(OCC(=O)Nc3ccc(N4CCC(C)CC4)cc3)c2n1 |
| InChI | InChI=1S/C22H26N4O2/c1-16-9-12-25(13-10-16)19-7-5-18(6-8-19)24-21(27)15-28-20-4-3-11-26-14-17(2)23-22(20)26/h3-8,11,14,16H,9-10,12-13,15H2,1-2H3,(H,24,27) |
| InChIKey | IYVCPZDPXYKMNZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|