C16H13FN4O4 — CID 110500359
N-(3-fluoro-4-nitrophenyl)-2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxyacetamide (PubChem CID 110500359) has the molecular formula C16H13FN4O4 and a molecular weight of 344.30 g/mol. Its IUPAC name is N-(3-fluoro-4-nitrophenyl)-2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxyacetamide.
| Compound Name | N-(3-fluoro-4-nitrophenyl)-2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxyacetamide |
|---|---|
| PubChem CID | 110500359 |
| Molecular Formula | C16H13FN4O4 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-(3-fluoro-4-nitrophenyl)-2-(2-methylimidazo[1,2-a]pyridin-8-yl)oxyacetamide |
| SMILES | Cc1cn2cccc(OCC(=O)Nc3ccc([N+](=O)[O-])c(F)c3)c2n1 |
| InChI | InChI=1S/C16H13FN4O4/c1-10-8-20-6-2-3-14(16(20)18-10)25-9-15(22)19-11-4-5-13(21(23)24)12(17)7-11/h2-8H,9H2,1H3,(H,19,22) |
| InChIKey | VPUUQXAPECSMMA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|