C23H23FN2O5S2 — CID 110502542
ethyl 2-[2-[(4-fluorophenyl)sulfonylamino]butanoylamino]-4-phenylthiophene-3-carboxylate (PubChem CID 110502542) has the molecular formula C23H23FN2O5S2 and a molecular weight of 490.58 g/mol. Its IUPAC name is ethyl 2-[2-[(4-fluorophenyl)sulfonylamino]butanoylamino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[(4-fluorophenyl)sulfonylamino]butanoylamino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 110502542 |
| Molecular Formula | C23H23FN2O5S2 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | ethyl 2-[2-[(4-fluorophenyl)sulfonylamino]butanoylamino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C(CC)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H23FN2O5S2/c1-3-19(26-33(29,30)17-12-10-16(24)11-13-17)21(27)25-22-20(23(28)31-4-2)18(14-32-22)15-8-6-5-7-9-15/h5-14,19,26H,3-4H2,1-2H3,(H,25,27) |
| InChIKey | BCULUNNCBLIJLD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|