C20H21N5O6S — CID 110502698
4-O-ethyl 2-O-(2-phenoxyethyl) 3-methyl-5-[[2-(2H-tetrazol-5-yl)acetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 110502698) has the molecular formula C20H21N5O6S and a molecular weight of 459.48 g/mol. Its IUPAC name is 4-O-ethyl 2-O-(2-phenoxyethyl) 3-methyl-5-[[2-(2H-tetrazol-5-yl)acetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-(2-phenoxyethyl) 3-methyl-5-[[2-(2H-tetrazol-5-yl)acetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 110502698 |
| Molecular Formula | C20H21N5O6S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 4-O-ethyl 2-O-(2-phenoxyethyl) 3-methyl-5-[[2-(2H-tetrazol-5-yl)acetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)Cc2nn[nH]n2)sc(C(=O)OCCOc2ccccc2)c1C |
| InChI | InChI=1S/C20H21N5O6S/c1-3-29-19(27)16-12(2)17(20(28)31-10-9-30-13-7-5-4-6-8-13)32-18(16)21-15(26)11-14-22-24-25-23-14/h4-8H,3,9-11H2,1-2H3,(H,21,26)(H,22,23,24,25) |
| InChIKey | WHCHDIBFGKLNLU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|