C21H23NO7S — CID 110503483
diethyl 2-[[(E)-3-[4-(methoxymethoxy)phenyl]prop-2-enoyl]amino]thiophene-3,4-dicarboxylate (PubChem CID 110503483) has the molecular formula C21H23NO7S and a molecular weight of 433.48 g/mol. Its IUPAC name is diethyl 2-[[(E)-3-[4-(methoxymethoxy)phenyl]prop-2-enoyl]amino]thiophene-3,4-dicarboxylate.
| Compound Name | diethyl 2-[[(E)-3-[4-(methoxymethoxy)phenyl]prop-2-enoyl]amino]thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 110503483 |
| Molecular Formula | C21H23NO7S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | diethyl 2-[[(E)-3-[4-(methoxymethoxy)phenyl]prop-2-enoyl]amino]thiophene-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)/C=C/c2ccc(OCOC)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C21H23NO7S/c1-4-27-20(24)16-12-30-19(18(16)21(25)28-5-2)22-17(23)11-8-14-6-9-15(10-7-14)29-13-26-3/h6-12H,4-5,13H2,1-3H3,(H,22,23)/b11-8+ |
| InChIKey | LJIHACUVGYBTOV-DHZHZOJOSA-N |
| XLogP | 3.74 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|