C12H13BrN2O6 — CID 110506991
2-[[(Z)-(2-bromo-3-hydroxy-4-methoxyphenyl)methylideneamino]-(carboxymethyl)amino]acetic acid (PubChem CID 110506991) has the molecular formula C12H13BrN2O6 and a molecular weight of 361.15 g/mol. Its IUPAC name is 2-[[(Z)-(2-bromo-3-hydroxy-4-methoxyphenyl)methylideneamino]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[(Z)-(2-bromo-3-hydroxy-4-methoxyphenyl)methylideneamino]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 110506991 |
| Molecular Formula | C12H13BrN2O6 |
| Molecular Weight | 361.15 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 2-[[(Z)-(2-bromo-3-hydroxy-4-methoxyphenyl)methylideneamino]-(carboxymethyl)amino]acetic acid |
| SMILES | COc1ccc(/C=N\N(CC(=O)O)CC(=O)O)c(Br)c1O |
| InChI | InChI=1S/C12H13BrN2O6/c1-21-8-3-2-7(11(13)12(8)20)4-14-15(5-9(16)17)6-10(18)19/h2-4,20H,5-6H2,1H3,(H,16,17)(H,18,19)/b14-4- |
| InChIKey | YQSGWXJCMUFHMJ-CPSFFCFKSA-N |
| XLogP | 0.97 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|