C14H16Br2N2O5 — CID 110507065
2-[carboxymethyl-[(Z)-(3,5-dibromo-4-propan-2-yloxyphenyl)methylideneamino]amino]acetic acid (PubChem CID 110507065) has the molecular formula C14H16Br2N2O5 and a molecular weight of 452.10 g/mol. Its IUPAC name is 2-[carboxymethyl-[(Z)-(3,5-dibromo-4-propan-2-yloxyphenyl)methylideneamino]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(Z)-(3,5-dibromo-4-propan-2-yloxyphenyl)methylideneamino]amino]acetic acid |
|---|---|
| PubChem CID | 110507065 |
| Molecular Formula | C14H16Br2N2O5 |
| Molecular Weight | 452.10 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | 2-[carboxymethyl-[(Z)-(3,5-dibromo-4-propan-2-yloxyphenyl)methylideneamino]amino]acetic acid |
| SMILES | CC(C)Oc1c(Br)cc(/C=N\N(CC(=O)O)CC(=O)O)cc1Br |
| InChI | InChI=1S/C14H16Br2N2O5/c1-8(2)23-14-10(15)3-9(4-11(14)16)5-17-18(6-12(19)20)7-13(21)22/h3-5,8H,6-7H2,1-2H3,(H,19,20)(H,21,22)/b17-5- |
| InChIKey | GDOFGQCBNABPAG-ZWSORDCHSA-N |
| XLogP | 2.80 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.10 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|