C20H29ClN2O5 — CID 110506998
2-[carboxymethyl-[(Z)-(3-chloro-4-nonoxyphenyl)methylideneamino]amino]acetic acid (PubChem CID 110506998) has the molecular formula C20H29ClN2O5 and a molecular weight of 412.91 g/mol. Its IUPAC name is 2-[carboxymethyl-[(Z)-(3-chloro-4-nonoxyphenyl)methylideneamino]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(Z)-(3-chloro-4-nonoxyphenyl)methylideneamino]amino]acetic acid |
|---|---|
| PubChem CID | 110506998 |
| Molecular Formula | C20H29ClN2O5 |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-[carboxymethyl-[(Z)-(3-chloro-4-nonoxyphenyl)methylideneamino]amino]acetic acid |
| SMILES | CCCCCCCCCOc1ccc(/C=N\N(CC(=O)O)CC(=O)O)cc1Cl |
| InChI | InChI=1S/C20H29ClN2O5/c1-2-3-4-5-6-7-8-11-28-18-10-9-16(12-17(18)21)13-22-23(14-19(24)25)15-20(26)27/h9-10,12-13H,2-8,11,14-15H2,1H3,(H,24,25)(H,26,27)/b22-13- |
| InChIKey | PFBVBSOIDAPSKS-XKZIYDEJSA-N |
| XLogP | 4.27 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|