C50H52Cl4N2O6 — CID 101153442
[2,4-dichloro-5-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate (PubChem CID 101153442) has the molecular formula C50H52Cl4N2O6 and a molecular weight of 918.79 g/mol. Its IUPAC name is [2,4-dichloro-5-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate.
| Compound Name | [2,4-dichloro-5-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 101153442 |
| Molecular Formula | C50H52Cl4N2O6 |
| Molecular Weight | 918.79 g/mol |
| Exact Mass | 916.26 |
| IUPAC Name | [2,4-dichloro-5-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(/N=C/c2ccc(C(=O)Oc3cc(OC(=O)c4ccc(/C=N/c5ccc(OCCCCCCCC)c(Cl)c5)cc4)c(Cl)cc3Cl)cc2)cc1Cl |
| InChI | InChI=1S/C50H52Cl4N2O6/c1-3-5-7-9-11-13-27-59-45-25-23-39(29-41(45)51)55-33-35-15-19-37(20-16-35)49(57)61-47-32-48(44(54)31-43(47)53)62-50(58)38-21-17-36(18-22-38)34-56-40-24-26-46(42(52)30-40)60-28-14-12-10-8-6-4-2/h15-26,29-34H,3-14,27-28H2,1-2H3/b55-33+,56-34+ |
| InChIKey | YCMZMLFUVZFNAG-JPCJTSISSA-N |
| XLogP | 15.72 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.79 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|