C50H53Cl2N3O8 — CID 101153428
[3-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxy-2-nitrophenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate (PubChem CID 101153428) has the molecular formula C50H53Cl2N3O8 and a molecular weight of 894.89 g/mol. Its IUPAC name is [3-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxy-2-nitrophenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate.
| Compound Name | [3-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxy-2-nitrophenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 101153428 |
| Molecular Formula | C50H53Cl2N3O8 |
| Molecular Weight | 894.89 g/mol |
| Exact Mass | 893.32 |
| IUPAC Name | [3-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxy-2-nitrophenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(/N=C/c2ccc(C(=O)Oc3cccc(OC(=O)c4ccc(/C=N/c5ccc(OCCCCCCCC)c(Cl)c5)cc4)c3[N+](=O)[O-])cc2)cc1Cl |
| InChI | InChI=1S/C50H53Cl2N3O8/c1-3-5-7-9-11-13-30-60-44-28-26-40(32-42(44)51)53-34-36-18-22-38(23-19-36)49(56)62-46-16-15-17-47(48(46)55(58)59)63-50(57)39-24-20-37(21-25-39)35-54-41-27-29-45(43(52)33-41)61-31-14-12-10-8-6-4-2/h15-29,32-35H,3-14,30-31H2,1-2H3/b53-34+,54-35+ |
| InChIKey | ALTQVNYEODTPHV-NCJBMTRTSA-N |
| XLogP | 14.32 |
| TPSA | 138.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.89 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|