C50H53Cl3N2O6 — CID 101379625
[2-chloro-3-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate (PubChem CID 101379625) has the molecular formula C50H53Cl3N2O6 and a molecular weight of 884.34 g/mol. Its IUPAC name is [2-chloro-3-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate.
| Compound Name | [2-chloro-3-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 101379625 |
| Molecular Formula | C50H53Cl3N2O6 |
| Molecular Weight | 884.34 g/mol |
| Exact Mass | 882.30 |
| IUPAC Name | [2-chloro-3-[4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoyl]oxyphenyl] 4-[(3-chloro-4-octoxyphenyl)iminomethyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(/N=C/c2ccc(C(=O)Oc3cccc(OC(=O)c4ccc(/C=N/c5ccc(OCCCCCCCC)c(Cl)c5)cc4)c3Cl)cc2)cc1Cl |
| InChI | InChI=1S/C50H53Cl3N2O6/c1-3-5-7-9-11-13-30-58-44-28-26-40(32-42(44)51)54-34-36-18-22-38(23-19-36)49(56)60-46-16-15-17-47(48(46)53)61-50(57)39-24-20-37(21-25-39)35-55-41-27-29-45(43(52)33-41)59-31-14-12-10-8-6-4-2/h15-29,32-35H,3-14,30-31H2,1-2H3/b54-34+,55-35+ |
| InChIKey | LGIJDHCDDJTSBH-UGCUELSSSA-N |
| XLogP | 15.06 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.34 |
| LogP ≤ 5 | 15.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|