C47H45Cl2N3O6 — CID 101379626
[3-[4-[(3-chloro-4-hexoxyphenyl)iminomethyl]benzoyl]oxy-4-cyanophenyl] 4-[(3-chloro-4-hexoxyphenyl)iminomethyl]benzoate (PubChem CID 101379626) has the molecular formula C47H45Cl2N3O6 and a molecular weight of 818.80 g/mol. Its IUPAC name is [3-[4-[(3-chloro-4-hexoxyphenyl)iminomethyl]benzoyl]oxy-4-cyanophenyl] 4-[(3-chloro-4-hexoxyphenyl)iminomethyl]benzoate.
| Compound Name | [3-[4-[(3-chloro-4-hexoxyphenyl)iminomethyl]benzoyl]oxy-4-cyanophenyl] 4-[(3-chloro-4-hexoxyphenyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 101379626 |
| Molecular Formula | C47H45Cl2N3O6 |
| Molecular Weight | 818.80 g/mol |
| Exact Mass | 817.27 |
| IUPAC Name | [3-[4-[(3-chloro-4-hexoxyphenyl)iminomethyl]benzoyl]oxy-4-cyanophenyl] 4-[(3-chloro-4-hexoxyphenyl)iminomethyl]benzoate |
| SMILES | CCCCCCOc1ccc(/N=C/c2ccc(C(=O)Oc3ccc(C#N)c(OC(=O)c4ccc(/C=N/c5ccc(OCCCCCC)c(Cl)c5)cc4)c3)cc2)cc1Cl |
| InChI | InChI=1S/C47H45Cl2N3O6/c1-3-5-7-9-25-55-43-23-20-38(27-41(43)48)51-31-33-11-15-35(16-12-33)46(53)57-40-22-19-37(30-50)45(29-40)58-47(54)36-17-13-34(14-18-36)32-52-39-21-24-44(42(49)28-39)56-26-10-8-6-4-2/h11-24,27-29,31-32H,3-10,25-26H2,1-2H3/b51-31+,52-32+ |
| InChIKey | BPKWFFKVOFMPOB-XUBDYVCFSA-N |
| XLogP | 12.72 |
| TPSA | 119.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.80 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|