C12H13BrN2O5 — CID 110506957
2-[[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-(carboxymethyl)amino]acetic acid (PubChem CID 110506957) has the molecular formula C12H13BrN2O5 and a molecular weight of 345.15 g/mol. Its IUPAC name is 2-[[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 110506957 |
| Molecular Formula | C12H13BrN2O5 |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 2-[[(Z)-(3-bromo-4-methoxyphenyl)methylideneamino]-(carboxymethyl)amino]acetic acid |
| SMILES | COc1ccc(/C=N\N(CC(=O)O)CC(=O)O)cc1Br |
| InChI | InChI=1S/C12H13BrN2O5/c1-20-10-3-2-8(4-9(10)13)5-14-15(6-11(16)17)7-12(18)19/h2-5H,6-7H2,1H3,(H,16,17)(H,18,19)/b14-5- |
| InChIKey | JIKDMDOCYPWEND-RZNTYIFUSA-N |
| XLogP | 1.26 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|