C32H30I2N2O2 — CID 11050868
(2R,3R)-2,3-bis[(2-iodophenyl)methyl-methylamino]-1,4-diphenylbutane-1,4-dione (PubChem CID 11050868) has the molecular formula C32H30I2N2O2 and a molecular weight of 728.41 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(2-iodophenyl)methyl-methylamino]-1,4-diphenylbutane-1,4-dione.
| Compound Name | (2R,3R)-2,3-bis[(2-iodophenyl)methyl-methylamino]-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 11050868 |
| Molecular Formula | C32H30I2N2O2 |
| Molecular Weight | 728.41 g/mol |
| Exact Mass | 728.04 |
| IUPAC Name | (2R,3R)-2,3-bis[(2-iodophenyl)methyl-methylamino]-1,4-diphenylbutane-1,4-dione |
| SMILES | CN(Cc1ccccc1I)[C@@H](C(=O)c1ccccc1)[C@H](C(=O)c1ccccc1)N(C)Cc1ccccc1I |
| InChI | InChI=1S/C32H30I2N2O2/c1-35(21-25-17-9-11-19-27(25)33)29(31(37)23-13-5-3-6-14-23)30(32(38)24-15-7-4-8-16-24)36(2)22-26-18-10-12-20-28(26)34/h3-20,29-30H,21-22H2,1-2H3/t29-,30-/m1/s1 |
| InChIKey | HKCGNXJWPVMDNN-LOYHVIPDSA-N |
| XLogP | 6.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.41 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|