About N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide
N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide (PubChem CID 86040463) has the molecular formula C12H12INO
and a molecular weight of 313.14 g/mol. Its IUPAC name is N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide.
Molecular Properties
| Compound Name | N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide |
| PubChem CID | 86040463 |
| Molecular Formula | C12H12INO |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide |
| SMILES | C=C=CN(Cc1ccccc1I)C(C)=O |
| InChI | InChI=1S/C12H12INO/c1-3-8-14(10(2)15)9-11-6-4-5-7-12(11)13/h4-8H,1,9H2,2H3 |
| InChIKey | JDSJFBRGDQBPJW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide?
The IUPAC name of N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide (CID 86040463) is N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide.
What is the SMILES notation for N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide?
The canonical SMILES for N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide is C=C=CN(Cc1ccccc1I)C(C)=O.
What is the InChIKey of N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide?
The InChIKey is JDSJFBRGDQBPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12INO/c1-3-8-14(10(2)15)9-11-6-4-5-7-12(11)13/h4-8H,1,9H2,2H3.
What are the key properties of N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide?
N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide has a molecular weight of 313.14 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-iodophenyl)methyl]-N-propa-1,2-dienylacetamide is sourced from PubChem (CID 86040463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).