C17H14INO — CID 86040490
N-benzyl-2-iodo-N-propa-1,2-dienylbenzamide (PubChem CID 86040490) has the molecular formula C17H14INO and a molecular weight of 375.21 g/mol. Its IUPAC name is N-benzyl-2-iodo-N-propa-1,2-dienylbenzamide.
| Compound Name | N-benzyl-2-iodo-N-propa-1,2-dienylbenzamide |
|---|---|
| PubChem CID | 86040490 |
| Molecular Formula | C17H14INO |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | N-benzyl-2-iodo-N-propa-1,2-dienylbenzamide |
| SMILES | C=C=CN(Cc1ccccc1)C(=O)c1ccccc1I |
| InChI | InChI=1S/C17H14INO/c1-2-12-19(13-14-8-4-3-5-9-14)17(20)15-10-6-7-11-16(15)18/h3-12H,1,13H2 |
| InChIKey | PCHLKEFPEFJDGN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|