C18H16INO — CID 14663797
N-benzyl-N-[(1E)-buta-1,3-dienyl]-2-iodobenzamide (PubChem CID 14663797) has the molecular formula C18H16INO and a molecular weight of 389.24 g/mol. Its IUPAC name is N-benzyl-N-[(1E)-buta-1,3-dienyl]-2-iodobenzamide.
| Compound Name | N-benzyl-N-[(1E)-buta-1,3-dienyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 14663797 |
| Molecular Formula | C18H16INO |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | N-benzyl-N-[(1E)-buta-1,3-dienyl]-2-iodobenzamide |
| SMILES | C=C/C=C/N(Cc1ccccc1)C(=O)c1ccccc1I |
| InChI | InChI=1S/C18H16INO/c1-2-3-13-20(14-15-9-5-4-6-10-15)18(21)16-11-7-8-12-17(16)19/h2-13H,1,14H2/b13-3+ |
| InChIKey | AQEXJYHLEREKGN-QLKAYGNNSA-N |
| XLogP | 4.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|