About N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide
N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide (PubChem CID 11337195) has the molecular formula C15H18INO
and a molecular weight of 355.22 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide.
Molecular Properties
| Compound Name | N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide |
| PubChem CID | 11337195 |
| Molecular Formula | C15H18INO |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide |
| SMILES | C=C/C=C/N(CCCC)C(=O)c1ccccc1I |
| InChI | InChI=1S/C15H18INO/c1-3-5-11-17(12-6-4-2)15(18)13-9-7-8-10-14(13)16/h3,5,7-11H,1,4,6,12H2,2H3/b11-5+ |
| InChIKey | IEMUGGQBJUTRGX-VZUCSPMQSA-N |
| XLogP | 4.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide?
The IUPAC name of N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide (CID 11337195) is N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide.
What is the SMILES notation for N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide?
The canonical SMILES for N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide is C=C/C=C/N(CCCC)C(=O)c1ccccc1I.
What is the InChIKey of N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide?
The InChIKey is IEMUGGQBJUTRGX-VZUCSPMQSA-N. The full InChI is InChI=1S/C15H18INO/c1-3-5-11-17(12-6-4-2)15(18)13-9-7-8-10-14(13)16/h3,5,7-11H,1,4,6,12H2,2H3/b11-5+.
What are the key properties of N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide?
N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide has a molecular weight of 355.22 g/mol, XLogP of 4.23, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide is sourced from PubChem (CID 11337195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).