C15H18INO — CID 11337195
N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide (PubChem CID 11337195) has the molecular formula C15H18INO and a molecular weight of 355.22 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide.
| Compound Name | N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide |
|---|---|
| PubChem CID | 11337195 |
| Molecular Formula | C15H18INO |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]-N-butyl-2-iodobenzamide |
| SMILES | C=C/C=C/N(CCCC)C(=O)c1ccccc1I |
| InChI | InChI=1S/C15H18INO/c1-3-5-11-17(12-6-4-2)15(18)13-9-7-8-10-14(13)16/h3,5,7-11H,1,4,6,12H2,2H3/b11-5+ |
| InChIKey | IEMUGGQBJUTRGX-VZUCSPMQSA-N |
| XLogP | 4.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|