C25H23IN2O — CID 11431893
N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide (PubChem CID 11431893) has the molecular formula C25H23IN2O and a molecular weight of 494.38 g/mol. Its IUPAC name is N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide.
| Compound Name | N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide |
|---|---|
| PubChem CID | 11431893 |
| Molecular Formula | C25H23IN2O |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide |
| SMILES | C=C=CN(Cc1ccccc1CNCc1ccccc1)C(=O)c1ccccc1I |
| InChI | InChI=1S/C25H23IN2O/c1-2-16-28(25(29)23-14-8-9-15-24(23)26)19-22-13-7-6-12-21(22)18-27-17-20-10-4-3-5-11-20/h3-16,27H,1,17-19H2 |
| InChIKey | UBAZPVWONVVSAU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|