About N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide
N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide (PubChem CID 11431893) has the molecular formula C25H23IN2O
and a molecular weight of 494.38 g/mol. Its IUPAC name is N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide.
Molecular Properties
| Compound Name | N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide |
| PubChem CID | 11431893 |
| Molecular Formula | C25H23IN2O |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide |
| SMILES | C=C=CN(Cc1ccccc1CNCc1ccccc1)C(=O)c1ccccc1I |
| InChI | InChI=1S/C25H23IN2O/c1-2-16-28(25(29)23-14-8-9-15-24(23)26)19-22-13-7-6-12-21(22)18-27-17-20-10-4-3-5-11-20/h3-16,27H,1,17-19H2 |
| InChIKey | UBAZPVWONVVSAU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide?
The IUPAC name of N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide (CID 11431893) is N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide.
What is the SMILES notation for N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide?
The canonical SMILES for N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide is C=C=CN(Cc1ccccc1CNCc1ccccc1)C(=O)c1ccccc1I.
What is the InChIKey of N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide?
The InChIKey is UBAZPVWONVVSAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23IN2O/c1-2-16-28(25(29)23-14-8-9-15-24(23)26)19-22-13-7-6-12-21(22)18-27-17-20-10-4-3-5-11-20/h3-16,27H,1,17-19H2.
What are the key properties of N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide?
N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide has a molecular weight of 494.38 g/mol, XLogP of 5.52, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-[(benzylamino)methyl]phenyl]methyl]-2-iodo-N-propa-1,2-dienylbenzamide is sourced from PubChem (CID 11431893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).