C43H51NO14 — CID 11051075
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetyl]oxan-2-yl]methyl acetate (PubChem CID 11051075) has the molecular formula C43H51NO14 and a molecular weight of 805.87 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11051075 |
| Molecular Formula | C43H51NO14 |
| Molecular Weight | 805.87 g/mol |
| Exact Mass | 805.33 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-[2-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetyl]oxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H](CC(=O)[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2NC(C)=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C43H51NO14/c1-26(45)44-36-37(57-35(25-51-27(2)46)39(55-28(3)47)40(36)56-29(4)48)33(49)21-34-38(52-22-30-15-9-6-10-16-30)41(53-23-31-17-11-7-12-18-31)42(43(50-5)58-34)54-24-32-19-13-8-14-20-32/h6-20,34-43H,21-25H2,1-5H3,(H,44,45)/t34-,35-,36+,37+,38-,39-,40-,41+,42+,43+/m1/s1 |
| InChIKey | PPYQMFVSADYADZ-FUVYYCKMSA-N |
| XLogP | 3.77 |
| TPSA | 180.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.87 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|